About nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol
nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol (PubChem CID 153499066) has the molecular formula C22H15N2NiO-
and a molecular weight of 382.07 g/mol. Its IUPAC name is nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol.
Molecular Properties
| Compound Name | nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol |
| PubChem CID | 153499066 |
| Molecular Formula | C22H15N2NiO- |
| Molecular Weight | 382.07 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol |
| SMILES | Oc1ccccc1-c1cccc(-c2cccc(-c3[c-]cccc3)n2)n1.[Ni] |
| InChI | InChI=1S/C22H15N2O.Ni/c25-22-15-5-4-10-17(22)19-12-7-14-21(24-19)20-13-6-11-18(23-20)16-8-2-1-3-9-16;/h1-8,10-15,25H;/q-1; |
| InChIKey | NMVFTEKUWDBWGI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.07 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol?
The IUPAC name of nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol (CID 153499066) is nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol.
What is the SMILES notation for nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol?
The canonical SMILES for nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol is Oc1ccccc1-c1cccc(-c2cccc(-c3[c-]cccc3)n2)n1.[Ni].
What is the InChIKey of nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol?
The InChIKey is NMVFTEKUWDBWGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15N2O.Ni/c25-22-15-5-4-10-17(22)19-12-7-14-21(24-19)20-13-6-11-18(23-20)16-8-2-1-3-9-16;/h1-8,10-15,25H;/q-1;.
What are the key properties of nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol?
nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol has a molecular weight of 382.07 g/mol, XLogP of 4.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;2-[6-(6-phenyl-2-pyridinyl)-2-pyridinyl]phenol is sourced from PubChem (CID 153499066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).