C40H38N3OPt- — CID 156666168
2-[5-(2,6-dimethylphenyl)-1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]-6-(6-phenyl-2-pyridinyl)phenol;platinum (PubChem CID 156666168) has the molecular formula C40H38N3OPt- and a molecular weight of 771.84 g/mol. Its IUPAC name is 2-[5-(2,6-dimethylphenyl)-1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]-6-(6-phenyl-2-pyridinyl)phenol;platinum.
| Compound Name | 2-[5-(2,6-dimethylphenyl)-1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]-6-(6-phenyl-2-pyridinyl)phenol;platinum |
|---|---|
| PubChem CID | 156666168 |
| Molecular Formula | C40H38N3OPt- |
| Molecular Weight | 771.84 g/mol |
| Exact Mass | 771.27 |
| IUPAC Name | 2-[5-(2,6-dimethylphenyl)-1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]-6-(6-phenyl-2-pyridinyl)phenol;platinum |
| SMILES | Cc1cccc(C)c1-c1cnc(-c2cccc(-c3cccc(-c4[c-]cccc4)n3)c2O)n1-c1c(C(C)C)cccc1C(C)C.[Pt] |
| InChI | InChI=1S/C40H38N3O.Pt/c1-25(2)30-18-11-19-31(26(3)4)38(30)43-36(37-27(5)14-10-15-28(37)6)24-41-40(43)33-21-12-20-32(39(33)44)35-23-13-22-34(42-35)29-16-8-7-9-17-29;/h7-16,18-26,44H,1-6H3;/q-1; |
| InChIKey | TWVCRMAGWOXZFN-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.84 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|