C32H35BIrN3- — CID 166043743
1-(2,6-dimethylphenyl)-7-[2,6-di(propan-2-yl)phenyl]-2-methyl-6-phenylimidazo[4,5-c]azaborinine;iridium (PubChem CID 166043743) has the molecular formula C32H35BIrN3- and a molecular weight of 664.68 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-7-[2,6-di(propan-2-yl)phenyl]-2-methyl-6-phenylimidazo[4,5-c]azaborinine;iridium.
| Compound Name | 1-(2,6-dimethylphenyl)-7-[2,6-di(propan-2-yl)phenyl]-2-methyl-6-phenylimidazo[4,5-c]azaborinine;iridium |
|---|---|
| PubChem CID | 166043743 |
| Molecular Formula | C32H35BIrN3- |
| Molecular Weight | 664.68 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-7-[2,6-di(propan-2-yl)phenyl]-2-methyl-6-phenylimidazo[4,5-c]azaborinine;iridium |
| SMILES | Cc1cccc(C)c1B1c2c(nc(-c3[c-]cccc3)n2-c2c(C(C)C)cccc2C(C)C)C=CN1C.[Ir] |
| InChI | InChI=1S/C32H35BN3.Ir/c1-21(2)26-17-12-18-27(22(3)4)30(26)36-31-28(34-32(36)25-15-9-8-10-16-25)19-20-35(7)33(31)29-23(5)13-11-14-24(29)6;/h8-15,17-22H,1-7H3;/q-1; |
| InChIKey | FMHVSOVEQHZSJA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.68 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|