C30H29BIrN3- — CID 166043799
CID 166043799 (PubChem CID 166043799) has the molecular formula C30H29BIrN3- and a molecular weight of 634.61 g/mol.
| Compound Name | CID 166043799 |
|---|---|
| PubChem CID | 166043799 |
| Molecular Formula | C30H29BIrN3- |
| Molecular Weight | 634.61 g/mol |
| Exact Mass | 635.21 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1B1c2c(nc3c4[c-]cccc4c4ccccc4n23)C=CN1C.[Ir] |
| InChI | InChI=1S/C30H29BN3.Ir/c1-19(2)21-14-10-15-22(20(3)4)28(21)31-29-26(17-18-33(31)5)32-30-25-13-7-6-11-23(25)24-12-8-9-16-27(24)34(29)30;/h6-12,14-20H,1-5H3;/q-1; |
| InChIKey | RRQLWGKVEDWYHK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|