C38H37BIrN3O- — CID 166043807
6-(3H-dibenzofuran-3-id-4-yl)-1-(2,6-dimethylphenyl)-7-[2,6-di(propan-2-yl)phenyl]-2-methylimidazo[4,5-c]azaborinine;iridium (PubChem CID 166043807) has the molecular formula C38H37BIrN3O- and a molecular weight of 754.76 g/mol. Its IUPAC name is 6-(3H-dibenzofuran-3-id-4-yl)-1-(2,6-dimethylphenyl)-7-[2,6-di(propan-2-yl)phenyl]-2-methylimidazo[4,5-c]azaborinine;iridium.
| Compound Name | 6-(3H-dibenzofuran-3-id-4-yl)-1-(2,6-dimethylphenyl)-7-[2,6-di(propan-2-yl)phenyl]-2-methylimidazo[4,5-c]azaborinine;iridium |
|---|---|
| PubChem CID | 166043807 |
| Molecular Formula | C38H37BIrN3O- |
| Molecular Weight | 754.76 g/mol |
| Exact Mass | 755.27 |
| IUPAC Name | 6-(3H-dibenzofuran-3-id-4-yl)-1-(2,6-dimethylphenyl)-7-[2,6-di(propan-2-yl)phenyl]-2-methylimidazo[4,5-c]azaborinine;iridium |
| SMILES | Cc1cccc(C)c1B1c2c(nc(-c3[c-]ccc4c3oc3ccccc34)n2-c2c(C(C)C)cccc2C(C)C)C=CN1C.[Ir] |
| InChI | InChI=1S/C38H37BN3O.Ir/c1-23(2)27-16-11-17-28(24(3)4)35(27)42-37-32(21-22-41(7)39(37)34-25(5)13-10-14-26(34)6)40-38(42)31-19-12-18-30-29-15-8-9-20-33(29)43-36(30)31;/h8-18,20-24H,1-7H3;/q-1; |
| InChIKey | ICAGTBOZIMMSFQ-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 34.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.76 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|