About CID 166043784
CID 166043784 (PubChem CID 166043784) has the molecular formula C29H29B2IrN4-
and a molecular weight of 647.42 g/mol.
Molecular Properties
| Compound Name | CID 166043784 |
| PubChem CID | 166043784 |
| Molecular Formula | C29H29B2IrN4- |
| Molecular Weight | 647.42 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1B1c2c(nc3n2B(c2c(C)cccc2C)N(C)c2ccc[c-]c2-3)C=CN1C.[Ir] |
| InChI | InChI=1S/C29H29B2N4.Ir/c1-19-11-9-12-20(2)26(19)30-28-24(17-18-33(30)5)32-29-23-15-7-8-16-25(23)34(6)31(35(28)29)27-21(3)13-10-14-22(27)4;/h7-14,16-18H,1-6H3;/q-1; |
| InChIKey | NVZKGWXTPPVWQI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 647.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 166043784 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166043784?
The IUPAC name of CID 166043784 (CID 166043784) is not available.
What is the SMILES notation for CID 166043784?
The canonical SMILES for CID 166043784 is Cc1cccc(C)c1B1c2c(nc3n2B(c2c(C)cccc2C)N(C)c2ccc[c-]c2-3)C=CN1C.[Ir].
What is the InChIKey of CID 166043784?
The InChIKey is NVZKGWXTPPVWQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H29B2N4.Ir/c1-19-11-9-12-20(2)26(19)30-28-24(17-18-33(30)5)32-29-23-15-7-8-16-25(23)34(6)31(35(28)29)27-21(3)13-10-14-22(27)4;/h7-14,16-18H,1-6H3;/q-1;.
What are the key properties of CID 166043784?
CID 166043784 has a molecular weight of 647.42 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166043784 is sourced from PubChem (CID 166043784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).