C29H29B2IrN4- — CID 166043784
CID 166043784 (PubChem CID 166043784) has the molecular formula C29H29B2IrN4- and a molecular weight of 647.42 g/mol.
| Compound Name | CID 166043784 |
|---|---|
| PubChem CID | 166043784 |
| Molecular Formula | C29H29B2IrN4- |
| Molecular Weight | 647.42 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1B1c2c(nc3n2B(c2c(C)cccc2C)N(C)c2ccc[c-]c2-3)C=CN1C.[Ir] |
| InChI | InChI=1S/C29H29B2N4.Ir/c1-19-11-9-12-20(2)26(19)30-28-24(17-18-33(30)5)32-29-23-15-7-8-16-25(23)34(6)31(35(28)29)27-21(3)13-10-14-22(27)4;/h7-14,16-18H,1-6H3;/q-1; |
| InChIKey | NVZKGWXTPPVWQI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|