C22H18B2IrN- — CID 153276206
CID 153276206 (PubChem CID 153276206) has the molecular formula C22H18B2IrN- and a molecular weight of 510.23 g/mol.
| Compound Name | CID 153276206 |
|---|---|
| PubChem CID | 153276206 |
| Molecular Formula | C22H18B2IrN- |
| Molecular Weight | 510.23 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | — |
| SMILES | CC1=NB2c3[c-]cccc3B(c3c(C)cccc3C)c3cccc1c32.[Ir] |
| InChI | InChI=1S/C22H18B2N.Ir/c1-14-8-6-9-15(2)21(14)23-18-11-4-5-12-19(18)24-22-17(16(3)25-24)10-7-13-20(22)23;/h4-11,13H,1-3H3;/q-1; |
| InChIKey | GJRSSCLYGPSSSF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|