C42H39B2IrN2O2- — CID 153276327
5-[5,10-bis(2,6-dimethylphenyl)boranthren-2-yl]-1-phenylpyrazole;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 153276327) has the molecular formula C42H39B2IrN2O2- and a molecular weight of 817.63 g/mol. Its IUPAC name is 5-[5,10-bis(2,6-dimethylphenyl)boranthren-2-yl]-1-phenylpyrazole;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 5-[5,10-bis(2,6-dimethylphenyl)boranthren-2-yl]-1-phenylpyrazole;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 153276327 |
| Molecular Formula | C42H39B2IrN2O2- |
| Molecular Weight | 817.63 g/mol |
| Exact Mass | 818.28 |
| IUPAC Name | 5-[5,10-bis(2,6-dimethylphenyl)boranthren-2-yl]-1-phenylpyrazole;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1cccc(C)c1B1c2ccccc2B(c2c(C)cccc2C)c2cc(-c3ccnn3-c3[c-]cccc3)ccc21.[Ir] |
| InChI | InChI=1S/C37H31B2N2.C5H8O2.Ir/c1-25-12-10-13-26(2)36(25)38-31-18-8-9-19-32(31)39(37-27(3)14-11-15-28(37)4)34-24-29(20-21-33(34)38)35-22-23-40-41(35)30-16-6-5-7-17-30;1-4(6)3-5(2)7;/h5-16,18-24H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | TXAYRHYCKURRFG-LWFKIUJUSA-N |
| XLogP | 4.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|