C44H40BIrN2O2- — CID 146957225
5,10-bis(2,6-dimethylphenyl)-4-(6-phenyl-3-pyridinyl)benzo[b][1,4]benzazaborinine;4-hydroxypent-3-en-2-one;iridium (PubChem CID 146957225) has the molecular formula C44H40BIrN2O2- and a molecular weight of 831.85 g/mol. Its IUPAC name is 5,10-bis(2,6-dimethylphenyl)-4-(6-phenyl-3-pyridinyl)benzo[b][1,4]benzazaborinine;4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 5,10-bis(2,6-dimethylphenyl)-4-(6-phenyl-3-pyridinyl)benzo[b][1,4]benzazaborinine;4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 146957225 |
| Molecular Formula | C44H40BIrN2O2- |
| Molecular Weight | 831.85 g/mol |
| Exact Mass | 832.28 |
| IUPAC Name | 5,10-bis(2,6-dimethylphenyl)-4-(6-phenyl-3-pyridinyl)benzo[b][1,4]benzazaborinine;4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)C=C(C)O.Cc1cccc(C)c1B1c2ccccc2N(c2c(C)cccc2C)c2c1cccc2-c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C39H32BN2.C5H8O2.Ir/c1-26-13-10-14-27(2)37(26)40-33-20-8-9-22-36(33)42(38-28(3)15-11-16-29(38)4)39-32(19-12-21-34(39)40)31-23-24-35(41-25-31)30-17-6-5-7-18-30;1-4(6)3-5(2)7;/h5-17,19-25H,1-4H3;3,6H,1-2H3;/q-1;; |
| InChIKey | TWPSBGBPKNWFQW-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.85 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|