C51H42BIrN3-2 — CID 153276255
5,10-bis(2,6-dimethylphenyl)-1-(6-phenyl-3-pyridinyl)benzo[b][1,4]benzazaborinine;iridium;5-methyl-2-phenylpyridine (PubChem CID 153276255) has the molecular formula C51H42BIrN3-2 and a molecular weight of 899.95 g/mol. Its IUPAC name is 5,10-bis(2,6-dimethylphenyl)-1-(6-phenyl-3-pyridinyl)benzo[b][1,4]benzazaborinine;iridium;5-methyl-2-phenylpyridine.
| Compound Name | 5,10-bis(2,6-dimethylphenyl)-1-(6-phenyl-3-pyridinyl)benzo[b][1,4]benzazaborinine;iridium;5-methyl-2-phenylpyridine |
|---|---|
| PubChem CID | 153276255 |
| Molecular Formula | C51H42BIrN3-2 |
| Molecular Weight | 899.95 g/mol |
| Exact Mass | 900.31 |
| IUPAC Name | 5,10-bis(2,6-dimethylphenyl)-1-(6-phenyl-3-pyridinyl)benzo[b][1,4]benzazaborinine;iridium;5-methyl-2-phenylpyridine |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.Cc1cccc(C)c1B1c2ccccc2N(c2c(C)cccc2C)c2cccc(-c3ccc(-c4[c-]cccc4)nc3)c21.[Ir] |
| InChI | InChI=1S/C39H32BN2.C12H10N.Ir/c1-26-13-10-14-27(2)37(26)40-33-20-8-9-21-35(33)42(39-28(3)15-11-16-29(39)4)36-22-12-19-32(38(36)40)31-23-24-34(41-25-31)30-17-6-5-7-18-30;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h5-17,19-25H,1-4H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | ZRNFEVNXTPLNLO-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.95 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|