C50H40IrN2-2 — CID 155602165
iridium;5-methyl-2-[3-[3-(3-phenylphenyl)phenyl]benzene-6-id-1-yl]pyridine;2-phenyl-5-(2,4,6-trimethylphenyl)pyridine (PubChem CID 155602165) has the molecular formula C50H40IrN2-2 and a molecular weight of 861.10 g/mol. Its IUPAC name is iridium;5-methyl-2-[3-[3-(3-phenylphenyl)phenyl]benzene-6-id-1-yl]pyridine;2-phenyl-5-(2,4,6-trimethylphenyl)pyridine.
| Compound Name | iridium;5-methyl-2-[3-[3-(3-phenylphenyl)phenyl]benzene-6-id-1-yl]pyridine;2-phenyl-5-(2,4,6-trimethylphenyl)pyridine |
|---|---|
| PubChem CID | 155602165 |
| Molecular Formula | C50H40IrN2-2 |
| Molecular Weight | 861.10 g/mol |
| Exact Mass | 861.28 |
| IUPAC Name | iridium;5-methyl-2-[3-[3-(3-phenylphenyl)phenyl]benzene-6-id-1-yl]pyridine;2-phenyl-5-(2,4,6-trimethylphenyl)pyridine |
| SMILES | Cc1cc(C)c(-c2ccc(-c3[c-]cccc3)nc2)c(C)c1.Cc1ccc(-c2[c-]ccc(-c3cccc(-c4cccc(-c5ccccc5)c4)c3)c2)nc1.[Ir] |
| InChI | InChI=1S/C30H22N.C20H18N.Ir/c1-22-16-17-30(31-21-22)29-15-7-14-28(20-29)27-13-6-12-26(19-27)25-11-5-10-24(18-25)23-8-3-2-4-9-23;1-14-11-15(2)20(16(3)12-14)18-9-10-19(21-13-18)17-7-5-4-6-8-17;/h2-14,16-21H,1H3;4-7,9-13H,1-3H3;/q2*-1; |
| InChIKey | PQXBVPPAWWYLDO-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.10 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|