C54H38IrN2-2 — CID 164939579
iridium;5-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine;5-methyl-2-phenyl-4-tetraphenylen-2-ylpyridine (PubChem CID 164939579) has the molecular formula C54H38IrN2-2 and a molecular weight of 907.13 g/mol. Its IUPAC name is iridium;5-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine;5-methyl-2-phenyl-4-tetraphenylen-2-ylpyridine.
| Compound Name | iridium;5-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine;5-methyl-2-phenyl-4-tetraphenylen-2-ylpyridine |
|---|---|
| PubChem CID | 164939579 |
| Molecular Formula | C54H38IrN2-2 |
| Molecular Weight | 907.13 g/mol |
| Exact Mass | 907.27 |
| IUPAC Name | iridium;5-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine;5-methyl-2-phenyl-4-tetraphenylen-2-ylpyridine |
| SMILES | Cc1ccc(-c2[c-]ccc(-c3ccccc3)c2)nc1.Cc1cnc(-c2[c-]cccc2)cc1-c1ccc2c(c1)-c1ccccc1-c1ccccc1-c1ccccc1-2.[Ir] |
| InChI | InChI=1S/C36H24N.C18H14N.Ir/c1-24-23-37-36(25-11-3-2-4-12-25)22-34(24)26-19-20-33-31-17-8-7-15-29(31)27-13-5-6-14-28(27)30-16-9-10-18-32(30)35(33)21-26;1-14-10-11-18(19-13-14)17-9-5-8-16(12-17)15-6-3-2-4-7-15;/h2-11,13-23H,1H3;2-8,10-13H,1H3;/q2*-1;/b29-27-,30-28-,33-31-,35-32-;; |
| InChIKey | IKXKUVASKRASNZ-LFVOQBLKSA-N |
| XLogP | 14.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.13 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|