C44H45IrN3-2 — CID 155602207
5-(2,6-dimethylphenyl)-2-phenylpyridine;6-[3-(3-hexylphenyl)benzene-6-id-1-yl]-N,N-dimethylpyridin-3-amine;iridium (PubChem CID 155602207) has the molecular formula C44H45IrN3-2 and a molecular weight of 808.08 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)-2-phenylpyridine;6-[3-(3-hexylphenyl)benzene-6-id-1-yl]-N,N-dimethylpyridin-3-amine;iridium.
| Compound Name | 5-(2,6-dimethylphenyl)-2-phenylpyridine;6-[3-(3-hexylphenyl)benzene-6-id-1-yl]-N,N-dimethylpyridin-3-amine;iridium |
|---|---|
| PubChem CID | 155602207 |
| Molecular Formula | C44H45IrN3-2 |
| Molecular Weight | 808.08 g/mol |
| Exact Mass | 808.33 |
| IUPAC Name | 5-(2,6-dimethylphenyl)-2-phenylpyridine;6-[3-(3-hexylphenyl)benzene-6-id-1-yl]-N,N-dimethylpyridin-3-amine;iridium |
| SMILES | CCCCCCc1cccc(-c2cc[c-]c(-c3ccc(N(C)C)cn3)c2)c1.Cc1cccc(C)c1-c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C25H29N2.C19H16N.Ir/c1-4-5-6-7-10-20-11-8-12-21(17-20)22-13-9-14-23(18-22)25-16-15-24(19-26-25)27(2)3;1-14-7-6-8-15(2)19(14)17-11-12-18(20-13-17)16-9-4-3-5-10-16;/h8-9,11-13,15-19H,4-7,10H2,1-3H3;3-9,11-13H,1-2H3;/q2*-1; |
| InChIKey | IOQVHPKGXWQZAQ-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.08 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|