C25H30N2 — CID 155602208
6-[3-(3-hexylphenyl)phenyl]-N,N-dimethylpyridin-3-amine (PubChem CID 155602208) has the molecular formula C25H30N2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 6-[3-(3-hexylphenyl)phenyl]-N,N-dimethylpyridin-3-amine.
| Compound Name | 6-[3-(3-hexylphenyl)phenyl]-N,N-dimethylpyridin-3-amine |
|---|---|
| PubChem CID | 155602208 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 6-[3-(3-hexylphenyl)phenyl]-N,N-dimethylpyridin-3-amine |
| SMILES | CCCCCCc1cccc(-c2cccc(-c3ccc(N(C)C)cn3)c2)c1 |
| InChI | InChI=1S/C25H30N2/c1-4-5-6-7-10-20-11-8-12-21(17-20)22-13-9-14-23(18-22)25-16-15-24(19-26-25)27(2)3/h8-9,11-19H,4-7,10H2,1-3H3 |
| InChIKey | DTNXTIQMCYBVEI-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|