C49H44IrN2-2 — CID 155602230
5-hexyl-2-(3H-triphenylen-3-id-2-yl)pyridine;iridium;2-phenyl-5-(2,4,6-trimethylphenyl)pyridine (PubChem CID 155602230) has the molecular formula C49H44IrN2-2 and a molecular weight of 853.12 g/mol. Its IUPAC name is 5-hexyl-2-(3H-triphenylen-3-id-2-yl)pyridine;iridium;2-phenyl-5-(2,4,6-trimethylphenyl)pyridine.
| Compound Name | 5-hexyl-2-(3H-triphenylen-3-id-2-yl)pyridine;iridium;2-phenyl-5-(2,4,6-trimethylphenyl)pyridine |
|---|---|
| PubChem CID | 155602230 |
| Molecular Formula | C49H44IrN2-2 |
| Molecular Weight | 853.12 g/mol |
| Exact Mass | 853.31 |
| IUPAC Name | 5-hexyl-2-(3H-triphenylen-3-id-2-yl)pyridine;iridium;2-phenyl-5-(2,4,6-trimethylphenyl)pyridine |
| SMILES | CCCCCCc1ccc(-c2[c-]cc3c4ccccc4c4ccccc4c3c2)nc1.Cc1cc(C)c(-c2ccc(-c3[c-]cccc3)nc2)c(C)c1.[Ir] |
| InChI | InChI=1S/C29H26N.C20H18N.Ir/c1-2-3-4-5-10-21-15-18-29(30-20-21)22-16-17-27-25-13-7-6-11-23(25)24-12-8-9-14-26(24)28(27)19-22;1-14-11-15(2)20(16(3)12-14)18-9-10-19(21-13-18)17-7-5-4-6-8-17;/h6-9,11-15,17-20H,2-5,10H2,1H3;4-7,9-13H,1-3H3;/q2*-1; |
| InChIKey | RRSQRBYOYWMVAI-UHFFFAOYSA-N |
| XLogP | 13.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.12 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|