C58H56N2Pt — CID 58939495
platinum(2+);bis(5-(2,4,6-trimethylphenyl)-2-[4-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]pyridine) (PubChem CID 58939495) has the molecular formula C58H56N2Pt and a molecular weight of 976.18 g/mol. Its IUPAC name is platinum(2+);bis(5-(2,4,6-trimethylphenyl)-2-[4-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]pyridine).
| Compound Name | platinum(2+);bis(5-(2,4,6-trimethylphenyl)-2-[4-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]pyridine) |
|---|---|
| PubChem CID | 58939495 |
| Molecular Formula | C58H56N2Pt |
| Molecular Weight | 976.18 g/mol |
| Exact Mass | 975.41 |
| IUPAC Name | platinum(2+);bis(5-(2,4,6-trimethylphenyl)-2-[4-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]pyridine) |
| SMILES | Cc1cc(C)c(-c2c[c-]c(-c3ccc(-c4c(C)cc(C)cc4C)cn3)cc2)c(C)c1.Cc1cc(C)c(-c2c[c-]c(-c3ccc(-c4c(C)cc(C)cc4C)cn3)cc2)c(C)c1.[Pt+2] |
| InChI | InChI=1S/2C29H28N.Pt/c2*1-18-13-20(3)28(21(4)14-18)25-9-7-24(8-10-25)27-12-11-26(17-30-27)29-22(5)15-19(2)16-23(29)6;/h2*7,9-17H,1-6H3;/q2*-1;+2 |
| InChIKey | NRILONLBDZAQFQ-UHFFFAOYSA-N |
| XLogP | 15.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.18 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|