C23H24IrN- — CID 153419838
2-(4-tert-butylbenzene-6-id-1-yl)-5-(2,6-dimethylphenyl)pyridine;iridium (PubChem CID 153419838) has the molecular formula C23H24IrN- and a molecular weight of 506.67 g/mol. Its IUPAC name is 2-(4-tert-butylbenzene-6-id-1-yl)-5-(2,6-dimethylphenyl)pyridine;iridium.
| Compound Name | 2-(4-tert-butylbenzene-6-id-1-yl)-5-(2,6-dimethylphenyl)pyridine;iridium |
|---|---|
| PubChem CID | 153419838 |
| Molecular Formula | C23H24IrN- |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 2-(4-tert-butylbenzene-6-id-1-yl)-5-(2,6-dimethylphenyl)pyridine;iridium |
| SMILES | Cc1cccc(C)c1-c1ccc(-c2[c-]cc(C(C)(C)C)cc2)nc1.[Ir] |
| InChI | InChI=1S/C23H24N.Ir/c1-16-7-6-8-17(2)22(16)19-11-14-21(24-15-19)18-9-12-20(13-10-18)23(3,4)5;/h6-9,11-15H,1-5H3;/q-1; |
| InChIKey | UXESWHCXONUCEP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|