C14H9F7IrNO2- — CID 20870829
2-(4-fluorobenzene-6-id-1-yl)-5-(trifluoromethyl)pyridine;iridium;2,2,2-trifluoroethane-1,1-diol (PubChem CID 20870829) has the molecular formula C14H9F7IrNO2- and a molecular weight of 548.43 g/mol. Its IUPAC name is 2-(4-fluorobenzene-6-id-1-yl)-5-(trifluoromethyl)pyridine;iridium;2,2,2-trifluoroethane-1,1-diol.
| Compound Name | 2-(4-fluorobenzene-6-id-1-yl)-5-(trifluoromethyl)pyridine;iridium;2,2,2-trifluoroethane-1,1-diol |
|---|---|
| PubChem CID | 20870829 |
| Molecular Formula | C14H9F7IrNO2- |
| Molecular Weight | 548.43 g/mol |
| Exact Mass | 549.02 |
| IUPAC Name | 2-(4-fluorobenzene-6-id-1-yl)-5-(trifluoromethyl)pyridine;iridium;2,2,2-trifluoroethane-1,1-diol |
| SMILES | Fc1c[c-]c(-c2ccc(C(F)(F)F)cn2)cc1.OC(O)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C12H6F4N.C2H3F3O2.Ir/c13-10-4-1-8(2-5-10)11-6-3-9(7-17-11)12(14,15)16;3-2(4,5)1(6)7;/h1,3-7H;1,6-7H;/q-1;; |
| InChIKey | WHLNXHJDSPKTCX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|