C25H21ClN2Pt — CID 57326725
chloroplatinum(1+);2-[3-pyridin-2-yl-5-(2,4,6-trimethylphenyl)benzene-2-id-1-yl]pyridine (PubChem CID 57326725) has the molecular formula C25H21ClN2Pt and a molecular weight of 579.99 g/mol. Its IUPAC name is chloroplatinum(1+);2-[3-pyridin-2-yl-5-(2,4,6-trimethylphenyl)benzene-2-id-1-yl]pyridine.
| Compound Name | chloroplatinum(1+);2-[3-pyridin-2-yl-5-(2,4,6-trimethylphenyl)benzene-2-id-1-yl]pyridine |
|---|---|
| PubChem CID | 57326725 |
| Molecular Formula | C25H21ClN2Pt |
| Molecular Weight | 579.99 g/mol |
| Exact Mass | 579.10 |
| IUPAC Name | chloroplatinum(1+);2-[3-pyridin-2-yl-5-(2,4,6-trimethylphenyl)benzene-2-id-1-yl]pyridine |
| SMILES | Cc1cc(C)c(-c2cc(-c3ccccn3)[c-]c(-c3ccccn3)c2)c(C)c1.Cl[Pt+] |
| InChI | InChI=1S/C25H21N2.ClH.Pt/c1-17-12-18(2)25(19(3)13-17)22-15-20(23-8-4-6-10-26-23)14-21(16-22)24-9-5-7-11-27-24;;/h4-13,15-16H,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | WAPIQSKKBSKPHD-UHFFFAOYSA-M |
| XLogP | 6.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.99 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|