C23H30NOsP2+2 — CID 164740241
2-(3,5-dimethylbenzene-6-id-1-yl)pyridine;(2-dimethylphosphaniumylphenyl)-dimethylphosphanium;osmium(1+) (PubChem CID 164740241) has the molecular formula C23H30NOsP2+2 and a molecular weight of 572.68 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-6-id-1-yl)pyridine;(2-dimethylphosphaniumylphenyl)-dimethylphosphanium;osmium(1+).
| Compound Name | 2-(3,5-dimethylbenzene-6-id-1-yl)pyridine;(2-dimethylphosphaniumylphenyl)-dimethylphosphanium;osmium(1+) |
|---|---|
| PubChem CID | 164740241 |
| Molecular Formula | C23H30NOsP2+2 |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | 2-(3,5-dimethylbenzene-6-id-1-yl)pyridine;(2-dimethylphosphaniumylphenyl)-dimethylphosphanium;osmium(1+) |
| SMILES | C[PH+](C)c1ccccc1[PH+](C)C.Cc1[c-]c(-c2ccccn2)cc(C)c1.[Os+] |
| InChI | InChI=1S/C13H12N.C10H16P2.Os/c1-10-7-11(2)9-12(8-10)13-5-3-4-6-14-13;1-11(2)9-7-5-6-8-10(9)12(3)4;/h3-8H,1-2H3;5-8H,1-4H3;/q-1;;+1/p+2 |
| InChIKey | ZAFRWLMKRPJNBN-UHFFFAOYSA-P |
| XLogP | 5.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|