C23H25N2O2Pt- — CID 59661480
3-[2-(2,6-dimethylphenyl)benzene-6-id-1-yl]-1-methylpyrazole;(Z)-4-hydroxypent-3-en-2-one;platinum (PubChem CID 59661480) has the molecular formula C23H25N2O2Pt- and a molecular weight of 556.54 g/mol. Its IUPAC name is 3-[2-(2,6-dimethylphenyl)benzene-6-id-1-yl]-1-methylpyrazole;(Z)-4-hydroxypent-3-en-2-one;platinum.
| Compound Name | 3-[2-(2,6-dimethylphenyl)benzene-6-id-1-yl]-1-methylpyrazole;(Z)-4-hydroxypent-3-en-2-one;platinum |
|---|---|
| PubChem CID | 59661480 |
| Molecular Formula | C23H25N2O2Pt- |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 3-[2-(2,6-dimethylphenyl)benzene-6-id-1-yl]-1-methylpyrazole;(Z)-4-hydroxypent-3-en-2-one;platinum |
| SMILES | CC(=O)/C=C(/C)O.Cc1cccc(C)c1-c1ccc[c-]c1-c1ccn(C)n1.[Pt] |
| InChI | InChI=1S/C18H17N2.C5H8O2.Pt/c1-13-7-6-8-14(2)18(13)16-10-5-4-9-15(16)17-11-12-20(3)19-17;1-4(6)3-5(2)7;/h4-8,10-12H,1-3H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | WWBWLXCPWUVHJE-LWFKIUJUSA-N |
| XLogP | 5.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|