C19H19IrN2O2- — CID 59661422
(Z)-4-hydroxypent-3-en-2-one;iridium;1-methyl-3-(3H-naphthalen-3-id-2-yl)pyrazole (PubChem CID 59661422) has the molecular formula C19H19IrN2O2- and a molecular weight of 499.59 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;1-methyl-3-(3H-naphthalen-3-id-2-yl)pyrazole.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;1-methyl-3-(3H-naphthalen-3-id-2-yl)pyrazole |
|---|---|
| PubChem CID | 59661422 |
| Molecular Formula | C19H19IrN2O2- |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;1-methyl-3-(3H-naphthalen-3-id-2-yl)pyrazole |
| SMILES | CC(=O)/C=C(/C)O.Cn1ccc(-c2[c-]cc3ccccc3c2)n1.[Ir] |
| InChI | InChI=1S/C14H11N2.C5H8O2.Ir/c1-16-9-8-14(15-16)13-7-6-11-4-2-3-5-12(11)10-13;1-4(6)3-5(2)7;/h2-6,8-10H,1H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | RXWWFAXXEIQFNW-LWFKIUJUSA-N |
| XLogP | 4.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|