C8H9ClMg — CID 78061659
magnesium;1,2-dimethylbenzene-6-ide;chloride (PubChem CID 78061659) has the molecular formula C8H9ClMg and a molecular weight of 164.92 g/mol. Its IUPAC name is magnesium;1,2-dimethylbenzene-6-ide;chloride.
| Compound Name | magnesium;1,2-dimethylbenzene-6-ide;chloride |
|---|---|
| PubChem CID | 78061659 |
| Molecular Formula | C8H9ClMg |
| Molecular Weight | 164.92 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | magnesium;1,2-dimethylbenzene-6-ide;chloride |
| SMILES | Cc1[c-]cccc1C.[Cl-].[Mg+2] |
| InChI | InChI=1S/C8H9.ClH.Mg/c1-7-5-3-4-6-8(7)2;;/h3-5H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | APUBJCIRKJZPCG-UHFFFAOYSA-M |
| XLogP | -1.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.92 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|