About zinc;methylbenzene;chloride
zinc;methylbenzene;chloride (PubChem CID 22283008) has the molecular formula C7H7ClZn
and a molecular weight of 191.98 g/mol. Its IUPAC name is zinc;methylbenzene;chloride.
Molecular Properties
| Compound Name | zinc;methylbenzene;chloride |
| PubChem CID | 22283008 |
| Molecular Formula | C7H7ClZn |
| Molecular Weight | 191.98 g/mol |
| Exact Mass | 189.95 |
| IUPAC Name | zinc;methylbenzene;chloride |
| SMILES | Cc1[c-]cccc1.[Cl-].[Zn+2] |
| InChI | InChI=1S/C7H7.ClH.Zn/c1-7-5-3-2-4-6-7;;/h2-5H,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | MFWTZPHPCBLWAH-UHFFFAOYSA-M |
| XLogP | -1.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.98 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;methylbenzene;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;methylbenzene;chloride?
The IUPAC name of zinc;methylbenzene;chloride (CID 22283008) is zinc;methylbenzene;chloride.
What is the SMILES notation for zinc;methylbenzene;chloride?
The canonical SMILES for zinc;methylbenzene;chloride is Cc1[c-]cccc1.[Cl-].[Zn+2].
What is the InChIKey of zinc;methylbenzene;chloride?
The InChIKey is MFWTZPHPCBLWAH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7.ClH.Zn/c1-7-5-3-2-4-6-7;;/h2-5H,1H3;1H;/q-1;;+2/p-1.
What are the key properties of zinc;methylbenzene;chloride?
zinc;methylbenzene;chloride has a molecular weight of 191.98 g/mol, XLogP of -1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;methylbenzene;chloride is sourced from PubChem (CID 22283008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).