About carbanide;methylbenzene;uranium(2+)
carbanide;methylbenzene;uranium(2+) (PubChem CID 20703759) has the molecular formula C8H10U
and a molecular weight of 344.20 g/mol. Its IUPAC name is carbanide;methylbenzene;uranium(2+).
Molecular Properties
| Compound Name | carbanide;methylbenzene;uranium(2+) |
| PubChem CID | 20703759 |
| Molecular Formula | C8H10U |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | carbanide;methylbenzene;uranium(2+) |
| SMILES | Cc1[c-]cccc1.[CH3-].[U+2] |
| InChI | InChI=1S/C7H7.CH3.U/c1-7-5-3-2-4-6-7;;/h2-5H,1H3;1H3;/q2*-1;+2 |
| InChIKey | RICOJNIUDMXMSO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;methylbenzene;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;methylbenzene;uranium(2+)?
The IUPAC name of carbanide;methylbenzene;uranium(2+) (CID 20703759) is carbanide;methylbenzene;uranium(2+).
What is the SMILES notation for carbanide;methylbenzene;uranium(2+)?
The canonical SMILES for carbanide;methylbenzene;uranium(2+) is Cc1[c-]cccc1.[CH3-].[U+2].
What is the InChIKey of carbanide;methylbenzene;uranium(2+)?
The InChIKey is RICOJNIUDMXMSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.CH3.U/c1-7-5-3-2-4-6-7;;/h2-5H,1H3;1H3;/q2*-1;+2.
What are the key properties of carbanide;methylbenzene;uranium(2+)?
carbanide;methylbenzene;uranium(2+) has a molecular weight of 344.20 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;methylbenzene;uranium(2+) is sourced from PubChem (CID 20703759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).