About methylbenzene;propanoic acid;zinc
methylbenzene;propanoic acid;zinc (PubChem CID 175093711) has the molecular formula C10H13O2Zn-
and a molecular weight of 230.60 g/mol. Its IUPAC name is methylbenzene;propanoic acid;zinc.
Molecular Properties
| Compound Name | methylbenzene;propanoic acid;zinc |
| PubChem CID | 175093711 |
| Molecular Formula | C10H13O2Zn- |
| Molecular Weight | 230.60 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | methylbenzene;propanoic acid;zinc |
| SMILES | CCC(=O)O.Cc1[c-]cccc1.[Zn] |
| InChI | InChI=1S/C7H7.C3H6O2.Zn/c1-7-5-3-2-4-6-7;1-2-3(4)5;/h2-5H,1H3;2H2,1H3,(H,4,5);/q-1;; |
| InChIKey | PMFLXRDTFZVUTD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methylbenzene;propanoic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylbenzene;propanoic acid;zinc?
The IUPAC name of methylbenzene;propanoic acid;zinc (CID 175093711) is methylbenzene;propanoic acid;zinc.
What is the SMILES notation for methylbenzene;propanoic acid;zinc?
The canonical SMILES for methylbenzene;propanoic acid;zinc is CCC(=O)O.Cc1[c-]cccc1.[Zn].
What is the InChIKey of methylbenzene;propanoic acid;zinc?
The InChIKey is PMFLXRDTFZVUTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.C3H6O2.Zn/c1-7-5-3-2-4-6-7;1-2-3(4)5;/h2-5H,1H3;2H2,1H3,(H,4,5);/q-1;;.
What are the key properties of methylbenzene;propanoic acid;zinc?
methylbenzene;propanoic acid;zinc has a molecular weight of 230.60 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylbenzene;propanoic acid;zinc is sourced from PubChem (CID 175093711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).