About N-methyl-N-phenylaniline;yttrium
N-methyl-N-phenylaniline;yttrium (PubChem CID 59953259) has the molecular formula C13H11NY-2
and a molecular weight of 270.14 g/mol. Its IUPAC name is N-methyl-N-phenylaniline;yttrium.
Molecular Properties
| Compound Name | N-methyl-N-phenylaniline;yttrium |
| PubChem CID | 59953259 |
| Molecular Formula | C13H11NY-2 |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | N-methyl-N-phenylaniline;yttrium |
| SMILES | CN(c1[c-]cccc1)c1[c-]cccc1.[Y] |
| InChI | InChI=1S/C13H11N.Y/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;/h2-8,10H,1H3;/q-2; |
| InChIKey | NZGATOQGWLRSPM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-phenylaniline;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-phenylaniline;yttrium?
The IUPAC name of N-methyl-N-phenylaniline;yttrium (CID 59953259) is N-methyl-N-phenylaniline;yttrium.
What is the SMILES notation for N-methyl-N-phenylaniline;yttrium?
The canonical SMILES for N-methyl-N-phenylaniline;yttrium is CN(c1[c-]cccc1)c1[c-]cccc1.[Y].
What is the InChIKey of N-methyl-N-phenylaniline;yttrium?
The InChIKey is NZGATOQGWLRSPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N.Y/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;/h2-8,10H,1H3;/q-2;.
What are the key properties of N-methyl-N-phenylaniline;yttrium?
N-methyl-N-phenylaniline;yttrium has a molecular weight of 270.14 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-phenylaniline;yttrium is sourced from PubChem (CID 59953259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).