About 3-(N-methylanilino)propanenitrile;tris(yttrium)
3-(N-methylanilino)propanenitrile;tris(yttrium) (PubChem CID 58860588) has the molecular formula C10H11N2Y3-
and a molecular weight of 425.93 g/mol. Its IUPAC name is 3-(N-methylanilino)propanenitrile;tris(yttrium).
Molecular Properties
| Compound Name | 3-(N-methylanilino)propanenitrile;tris(yttrium) |
| PubChem CID | 58860588 |
| Molecular Formula | C10H11N2Y3- |
| Molecular Weight | 425.93 g/mol |
| Exact Mass | 425.81 |
| IUPAC Name | 3-(N-methylanilino)propanenitrile;tris(yttrium) |
| SMILES | CN(CCC#N)c1[c-]cccc1.[Y].[Y].[Y] |
| InChI | InChI=1S/C10H11N2.3Y/c1-12(9-5-8-11)10-6-3-2-4-7-10;;;/h2-4,6H,5,9H2,1H3;;;/q-1;;; |
| InChIKey | HRXMGNFDIBBXGM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.93 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-(N-methylanilino)propanenitrile;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(N-methylanilino)propanenitrile;tris(yttrium)?
The IUPAC name of 3-(N-methylanilino)propanenitrile;tris(yttrium) (CID 58860588) is 3-(N-methylanilino)propanenitrile;tris(yttrium).
What is the SMILES notation for 3-(N-methylanilino)propanenitrile;tris(yttrium)?
The canonical SMILES for 3-(N-methylanilino)propanenitrile;tris(yttrium) is CN(CCC#N)c1[c-]cccc1.[Y].[Y].[Y].
What is the InChIKey of 3-(N-methylanilino)propanenitrile;tris(yttrium)?
The InChIKey is HRXMGNFDIBBXGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N2.3Y/c1-12(9-5-8-11)10-6-3-2-4-7-10;;;/h2-4,6H,5,9H2,1H3;;;/q-1;;;.
What are the key properties of 3-(N-methylanilino)propanenitrile;tris(yttrium)?
3-(N-methylanilino)propanenitrile;tris(yttrium) has a molecular weight of 425.93 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(N-methylanilino)propanenitrile;tris(yttrium) is sourced from PubChem (CID 58860588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).