C17H17N3 — CID 146609408
3-[N-methyl-4-[(E)-2-pyridin-2-ylethenyl]anilino]propanenitrile (PubChem CID 146609408) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-[N-methyl-4-[(E)-2-pyridin-2-ylethenyl]anilino]propanenitrile.
| Compound Name | 3-[N-methyl-4-[(E)-2-pyridin-2-ylethenyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 146609408 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-[N-methyl-4-[(E)-2-pyridin-2-ylethenyl]anilino]propanenitrile |
| SMILES | CN(CCC#N)c1ccc(/C=C/c2ccccn2)cc1 |
| InChI | InChI=1S/C17H17N3/c1-20(14-4-12-18)17-10-7-15(8-11-17)6-9-16-5-2-3-13-19-16/h2-3,5-11,13H,4,14H2,1H3/b9-6+ |
| InChIKey | RUTVHMJYVQCOEY-RMKNXTFCSA-N |
| XLogP | 3.60 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|