C21H25N4+ — CID 23815947
3-[4-[(E)-2-[1-(2-aminoethyl)-6-ethenylpyridin-1-ium-2-yl]ethenyl]-N-methylanilino]propanenitrile (PubChem CID 23815947) has the molecular formula C21H25N4+ and a molecular weight of 333.46 g/mol. Its IUPAC name is 3-[4-[(E)-2-[1-(2-aminoethyl)-6-ethenylpyridin-1-ium-2-yl]ethenyl]-N-methylanilino]propanenitrile.
| Compound Name | 3-[4-[(E)-2-[1-(2-aminoethyl)-6-ethenylpyridin-1-ium-2-yl]ethenyl]-N-methylanilino]propanenitrile |
|---|---|
| PubChem CID | 23815947 |
| Molecular Formula | C21H25N4+ |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 3-[4-[(E)-2-[1-(2-aminoethyl)-6-ethenylpyridin-1-ium-2-yl]ethenyl]-N-methylanilino]propanenitrile |
| SMILES | C=Cc1cccc(/C=C/c2ccc(N(C)CCC#N)cc2)[n+]1CCN |
| InChI | InChI=1S/C21H25N4/c1-3-19-6-4-7-21(25(19)17-15-23)13-10-18-8-11-20(12-9-18)24(2)16-5-14-22/h3-4,6-13H,1,5,15-17,23H2,2H3/q+1 |
| InChIKey | RMXOZMVNMYCNII-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|