C14H20N3+ — CID 8024766
[4-[2-cyanoethyl(methyl)amino]phenyl]methyl-prop-2-enylazanium (PubChem CID 8024766) has the molecular formula C14H20N3+ and a molecular weight of 230.33 g/mol. Its IUPAC name is [4-[2-cyanoethyl(methyl)amino]phenyl]methyl-prop-2-enylazanium.
| Compound Name | [4-[2-cyanoethyl(methyl)amino]phenyl]methyl-prop-2-enylazanium |
|---|---|
| PubChem CID | 8024766 |
| Molecular Formula | C14H20N3+ |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | [4-[2-cyanoethyl(methyl)amino]phenyl]methyl-prop-2-enylazanium |
| SMILES | C=CC[NH2+]Cc1ccc(N(C)CCC#N)cc1 |
| InChI | InChI=1S/C14H19N3/c1-3-10-16-12-13-5-7-14(8-6-13)17(2)11-4-9-15/h3,5-8,16H,1,4,10-12H2,2H3/p+1 |
| InChIKey | KJTGKHZCYZIZLS-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 43.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|