C21H25N3 — CID 70223318
3-[4-[2-[4-(dimethylamino)phenyl]ethenyl]-N-ethylanilino]propanenitrile (PubChem CID 70223318) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-[4-[2-[4-(dimethylamino)phenyl]ethenyl]-N-ethylanilino]propanenitrile.
| Compound Name | 3-[4-[2-[4-(dimethylamino)phenyl]ethenyl]-N-ethylanilino]propanenitrile |
|---|---|
| PubChem CID | 70223318 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 3-[4-[2-[4-(dimethylamino)phenyl]ethenyl]-N-ethylanilino]propanenitrile |
| SMILES | CCN(CCC#N)c1ccc(C=Cc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H25N3/c1-4-24(17-5-16-22)21-14-10-19(11-15-21)7-6-18-8-12-20(13-9-18)23(2)3/h6-15H,4-5,17H2,1-3H3 |
| InChIKey | LUYGDBMURFPGFH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|