C24H21N3S — CID 139798131
3-[4-(2-benzo[e][1,3]benzothiazol-2-ylethenyl)-N-ethylanilino]propanenitrile (PubChem CID 139798131) has the molecular formula C24H21N3S and a molecular weight of 383.52 g/mol. Its IUPAC name is 3-[4-(2-benzo[e][1,3]benzothiazol-2-ylethenyl)-N-ethylanilino]propanenitrile.
| Compound Name | 3-[4-(2-benzo[e][1,3]benzothiazol-2-ylethenyl)-N-ethylanilino]propanenitrile |
|---|---|
| PubChem CID | 139798131 |
| Molecular Formula | C24H21N3S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-[4-(2-benzo[e][1,3]benzothiazol-2-ylethenyl)-N-ethylanilino]propanenitrile |
| SMILES | CCN(CCC#N)c1ccc(C=Cc2nc3c(ccc4ccccc43)s2)cc1 |
| InChI | InChI=1S/C24H21N3S/c1-2-27(17-5-16-25)20-12-8-18(9-13-20)10-15-23-26-24-21-7-4-3-6-19(21)11-14-22(24)28-23/h3-4,6-15H,2,5,17H2,1H3 |
| InChIKey | IZBPCCYMQGWRBQ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|