C37H38B2N+ — CID 153276394
2-[5,10-bis(2,6-dimethylphenyl)-3-methylboranthren-2-yl]-1,4,5-trimethylpyridin-1-ium (PubChem CID 153276394) has the molecular formula C37H38B2N+ and a molecular weight of 518.34 g/mol. Its IUPAC name is 2-[5,10-bis(2,6-dimethylphenyl)-3-methylboranthren-2-yl]-1,4,5-trimethylpyridin-1-ium.
| Compound Name | 2-[5,10-bis(2,6-dimethylphenyl)-3-methylboranthren-2-yl]-1,4,5-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 153276394 |
| Molecular Formula | C37H38B2N+ |
| Molecular Weight | 518.34 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | 2-[5,10-bis(2,6-dimethylphenyl)-3-methylboranthren-2-yl]-1,4,5-trimethylpyridin-1-ium |
| SMILES | Cc1cc(-c2cc3c(cc2C)B(c2c(C)cccc2C)c2ccccc2B3c2c(C)cccc2C)[n+](C)cc1C |
| InChI | InChI=1S/C37H38B2N/c1-23-13-11-14-24(2)36(23)38-31-17-9-10-18-32(31)39(37-25(3)15-12-16-26(37)4)34-21-30(28(6)19-33(34)38)35-20-27(5)29(7)22-40(35)8/h9-22H,1-8H3/q+1 |
| InChIKey | PUVCMWIVSHLQIB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|