C43H42B2N+ — CID 153276432
2-[10-(2,6-dimethylphenyl)-5-(2,6-dimethyl-4-phenylphenyl)-1-methylboranthren-2-yl]-1,4,5-trimethylpyridin-1-ium (PubChem CID 153276432) has the molecular formula C43H42B2N+ and a molecular weight of 594.44 g/mol. Its IUPAC name is 2-[10-(2,6-dimethylphenyl)-5-(2,6-dimethyl-4-phenylphenyl)-1-methylboranthren-2-yl]-1,4,5-trimethylpyridin-1-ium.
| Compound Name | 2-[10-(2,6-dimethylphenyl)-5-(2,6-dimethyl-4-phenylphenyl)-1-methylboranthren-2-yl]-1,4,5-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 153276432 |
| Molecular Formula | C43H42B2N+ |
| Molecular Weight | 594.44 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | 2-[10-(2,6-dimethylphenyl)-5-(2,6-dimethyl-4-phenylphenyl)-1-methylboranthren-2-yl]-1,4,5-trimethylpyridin-1-ium |
| SMILES | Cc1cc(-c2ccc3c(c2C)B(c2c(C)cccc2C)c2ccccc2B3c2c(C)cc(-c3ccccc3)cc2C)[n+](C)cc1C |
| InChI | InChI=1S/C43H42B2N/c1-27-15-14-16-28(2)41(27)45-38-20-13-12-19-37(38)44(42-30(4)23-35(24-31(42)5)34-17-10-9-11-18-34)39-22-21-36(33(7)43(39)45)40-25-29(3)32(6)26-46(40)8/h9-26H,1-8H3/q+1 |
| InChIKey | DNWINPIWJNPPEY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|