C40H44B2N+ — CID 153276261
2-[5,10-bis[2,6-bis(trideuteriomethyl)phenyl]-1-methylboranthren-2-yl]-4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methylpyridin-1-ium (PubChem CID 153276261) has the molecular formula C40H44B2N+ and a molecular weight of 574.51 g/mol. Its IUPAC name is 2-[5,10-bis[2,6-bis(trideuteriomethyl)phenyl]-1-methylboranthren-2-yl]-4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methylpyridin-1-ium.
| Compound Name | 2-[5,10-bis[2,6-bis(trideuteriomethyl)phenyl]-1-methylboranthren-2-yl]-4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 153276261 |
| Molecular Formula | C40H44B2N+ |
| Molecular Weight | 574.51 g/mol |
| Exact Mass | 574.45 |
| IUPAC Name | 2-[5,10-bis[2,6-bis(trideuteriomethyl)phenyl]-1-methylboranthren-2-yl]-4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methylpyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cccc(C([2H])([2H])[2H])c1B1c2ccccc2B(c2c(C([2H])([2H])[2H])cccc2C([2H])([2H])[2H])c2c1ccc(-c1cc(C([2H])([2H])C(C)(C)C)cc[n+]1C)c2C |
| InChI | InChI=1S/C40H44B2N/c1-26-14-12-15-27(2)37(26)41-33-18-10-11-19-34(33)42(38-28(3)16-13-17-29(38)4)39-30(5)32(20-21-35(39)41)36-24-31(22-23-43(36)9)25-40(6,7)8/h10-24H,25H2,1-9H3/q+1/i1D3,2D3,3D3,4D3,25D2 |
| InChIKey | QTRASMXFHIIDEW-VHXNKZLLSA-N |
| XLogP | 4.65 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|