C33H33B2N2+ — CID 159556617
1-[10-[2,6-bis(trideuteriomethyl)phenyl]-3-methyl-5-[2-methyl-6-(trideuteriomethyl)phenyl]boranthren-2-yl]-2-methylpyrazol-2-ium (PubChem CID 159556617) has the molecular formula C33H33B2N2+ and a molecular weight of 488.32 g/mol. Its IUPAC name is 1-[10-[2,6-bis(trideuteriomethyl)phenyl]-3-methyl-5-[2-methyl-6-(trideuteriomethyl)phenyl]boranthren-2-yl]-2-methylpyrazol-2-ium.
| Compound Name | 1-[10-[2,6-bis(trideuteriomethyl)phenyl]-3-methyl-5-[2-methyl-6-(trideuteriomethyl)phenyl]boranthren-2-yl]-2-methylpyrazol-2-ium |
|---|---|
| PubChem CID | 159556617 |
| Molecular Formula | C33H33B2N2+ |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | 1-[10-[2,6-bis(trideuteriomethyl)phenyl]-3-methyl-5-[2-methyl-6-(trideuteriomethyl)phenyl]boranthren-2-yl]-2-methylpyrazol-2-ium |
| SMILES | [2H]C([2H])([2H])c1cccc(C)c1B1c2ccccc2B(c2c(C([2H])([2H])[2H])cccc2C([2H])([2H])[2H])c2cc(-n3ccc[n+]3C)c(C)cc21 |
| InChI | InChI=1S/C33H33B2N2/c1-22-12-9-13-23(2)32(22)34-27-16-7-8-17-28(27)35(33-24(3)14-10-15-25(33)4)30-21-31(26(5)20-29(30)34)37-19-11-18-36(37)6/h7-21H,1-6H3/q+1/i1D3,3D3,4D3 |
| InChIKey | NZYPMYDZBLVWGF-MXOMHCEVSA-N |
| XLogP | 2.19 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|