C21H19BO — CID 167555800
10-[2,4-dimethyl-6-(trideuteriomethyl)phenyl]benzo[b][1,4]benzoxaborinine (PubChem CID 167555800) has the molecular formula C21H19BO and a molecular weight of 301.21 g/mol. Its IUPAC name is 10-[2,4-dimethyl-6-(trideuteriomethyl)phenyl]benzo[b][1,4]benzoxaborinine.
| Compound Name | 10-[2,4-dimethyl-6-(trideuteriomethyl)phenyl]benzo[b][1,4]benzoxaborinine |
|---|---|
| PubChem CID | 167555800 |
| Molecular Formula | C21H19BO |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 10-[2,4-dimethyl-6-(trideuteriomethyl)phenyl]benzo[b][1,4]benzoxaborinine |
| SMILES | [2H]C([2H])([2H])c1cc(C)cc(C)c1B1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C21H19BO/c1-14-12-15(2)21(16(3)13-14)22-17-8-4-6-10-19(17)23-20-11-7-5-9-18(20)22/h4-13H,1-3H3/i2D3 |
| InChIKey | CZMSHVLRKIVRQM-BMSJAHLVSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|