C19H15BO — CID 177073473
2-methyl-10-phenylbenzo[b][1,4]benzoxaborinine (PubChem CID 177073473) has the molecular formula C19H15BO and a molecular weight of 270.14 g/mol. Its IUPAC name is 2-methyl-10-phenylbenzo[b][1,4]benzoxaborinine.
| Compound Name | 2-methyl-10-phenylbenzo[b][1,4]benzoxaborinine |
|---|---|
| PubChem CID | 177073473 |
| Molecular Formula | C19H15BO |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-methyl-10-phenylbenzo[b][1,4]benzoxaborinine |
| SMILES | Cc1ccc2c(c1)B(c1ccccc1)c1ccccc1O2 |
| InChI | InChI=1S/C19H15BO/c1-14-11-12-19-17(13-14)20(15-7-3-2-4-8-15)16-9-5-6-10-18(16)21-19/h2-13H,1H3 |
| InChIKey | MFGWJCSRQKEAGH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|