C35H30BNO — CID 146995169
17,19-dimethyl-14-phenyl-11-(2,4,6-trimethylphenyl)-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 146995169) has the molecular formula C35H30BNO and a molecular weight of 491.44 g/mol. Its IUPAC name is 17,19-dimethyl-14-phenyl-11-(2,4,6-trimethylphenyl)-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 17,19-dimethyl-14-phenyl-11-(2,4,6-trimethylphenyl)-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 146995169 |
| Molecular Formula | C35H30BNO |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 17,19-dimethyl-14-phenyl-11-(2,4,6-trimethylphenyl)-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | Cc1cc(C)c(-c2cc3c4c(c2)N(c2ccccc2)c2cc(C)cc(C)c2B4c2ccccc2O3)c(C)c1 |
| InChI | InChI=1S/C35H30BNO/c1-21-15-23(3)33(24(4)16-21)26-19-30-35-32(20-26)38-31-14-10-9-13-28(31)36(35)34-25(5)17-22(2)18-29(34)37(30)27-11-7-6-8-12-27/h6-20H,1-5H3 |
| InChIKey | AQYKALWNPJFESP-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|