C69H59BN2 — CID 166005750
8,14-bis(4-phenylphenyl)-4,11,18-tris(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 166005750) has the molecular formula C69H59BN2 and a molecular weight of 927.06 g/mol. Its IUPAC name is 8,14-bis(4-phenylphenyl)-4,11,18-tris(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 8,14-bis(4-phenylphenyl)-4,11,18-tris(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 166005750 |
| Molecular Formula | C69H59BN2 |
| Molecular Weight | 927.06 g/mol |
| Exact Mass | 926.48 |
| IUPAC Name | 8,14-bis(4-phenylphenyl)-4,11,18-tris(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)B2c4cc(-c5c(C)cc(C)cc5C)ccc4N(c4ccc(-c5ccccc5)cc4)c4cc(-c5c(C)cc(C)cc5C)cc(c42)N3c2ccc(-c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C69H59BN2/c1-42-32-45(4)66(46(5)33-42)55-24-30-62-60(38-55)70-61-39-56(67-47(6)34-43(2)35-48(67)7)25-31-63(61)72(59-28-22-54(23-29-59)52-18-14-11-15-19-52)65-41-57(68-49(8)36-44(3)37-50(68)9)40-64(69(65)70)71(62)58-26-20-53(21-27-58)51-16-12-10-13-17-51/h10-41H,1-9H3 |
| InChIKey | FQGACIMFKFCPQP-UHFFFAOYSA-N |
| XLogP | 16.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.06 |
| LogP ≤ 5 | 16.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|