C64H73BN2 — CID 166005835
8,14-bis(3,5-ditert-butylphenyl)-4,11-bis(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaene (PubChem CID 166005835) has the molecular formula C64H73BN2 and a molecular weight of 881.11 g/mol. Its IUPAC name is 8,14-bis(3,5-ditert-butylphenyl)-4,11-bis(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaene.
| Compound Name | 8,14-bis(3,5-ditert-butylphenyl)-4,11-bis(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 166005835 |
| Molecular Formula | C64H73BN2 |
| Molecular Weight | 881.11 g/mol |
| Exact Mass | 880.59 |
| IUPAC Name | 8,14-bis(3,5-ditert-butylphenyl)-4,11-bis(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaene |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)B2c4ccccc4N(c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4cc(-c5c(C)cc(C)cc5C)cc(c42)N3c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C64H73BN2/c1-38-25-40(3)58(41(4)26-38)44-23-24-55-53(29-44)65-52-21-19-20-22-54(52)66(50-34-46(61(7,8)9)32-47(35-50)62(10,11)12)56-30-45(59-42(5)27-39(2)28-43(59)6)31-57(60(56)65)67(55)51-36-48(63(13,14)15)33-49(37-51)64(16,17)18/h19-37H,1-18H3 |
| InChIKey | BNJYDABPKLYQRK-UHFFFAOYSA-N |
| XLogP | 16.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.11 |
| LogP ≤ 5 | 16.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|