C57H59BN2 — CID 165152726
8,14-bis(3-tert-butylphenyl)-11-methyl-5,17-bis(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 165152726) has the molecular formula C57H59BN2 and a molecular weight of 782.92 g/mol. Its IUPAC name is 8,14-bis(3-tert-butylphenyl)-11-methyl-5,17-bis(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 8,14-bis(3-tert-butylphenyl)-11-methyl-5,17-bis(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 165152726 |
| Molecular Formula | C57H59BN2 |
| Molecular Weight | 782.92 g/mol |
| Exact Mass | 782.48 |
| IUPAC Name | 8,14-bis(3-tert-butylphenyl)-11-methyl-5,17-bis(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)N(c2cccc(C(C)(C)C)c2)c2cc(C)cc4c2B3c2ccc(-c3c(C)cc(C)cc3C)cc2N4c2cccc(C(C)(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C57H59BN2/c1-34-24-37(4)53(38(5)25-34)41-20-22-47-49(30-41)59(45-18-14-16-43(32-45)56(8,9)10)51-28-36(3)29-52-55(51)58(47)48-23-21-42(54-39(6)26-35(2)27-40(54)7)31-50(48)60(52)46-19-15-17-44(33-46)57(11,12)13/h14-33H,1-13H3 |
| InChIKey | YAGWNXORLCDLLS-UHFFFAOYSA-N |
| XLogP | 13.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.92 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|