C11H13N2+ — CID 59016991
2-methyl-1-(2-methylphenyl)pyrazol-2-ium (PubChem CID 59016991) has the molecular formula C11H13N2+ and a molecular weight of 173.24 g/mol. Its IUPAC name is 2-methyl-1-(2-methylphenyl)pyrazol-2-ium.
| Compound Name | 2-methyl-1-(2-methylphenyl)pyrazol-2-ium |
|---|---|
| PubChem CID | 59016991 |
| Molecular Formula | C11H13N2+ |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2-methyl-1-(2-methylphenyl)pyrazol-2-ium |
| SMILES | Cc1ccccc1-n1ccc[n+]1C |
| InChI | InChI=1S/C11H13N2/c1-10-6-3-4-7-11(10)13-9-5-8-12(13)2/h3-9H,1-2H3/q+1 |
| InChIKey | HIVSWYXVUZRJAO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|