C15H20N5+3 — CID 123422045
1,4-dimethyl-2,6-bis(2-methylpyrazol-2-ium-1-yl)pyridin-1-ium (PubChem CID 123422045) has the molecular formula C15H20N5+3 and a molecular weight of 270.36 g/mol. Its IUPAC name is 1,4-dimethyl-2,6-bis(2-methylpyrazol-2-ium-1-yl)pyridin-1-ium.
| Compound Name | 1,4-dimethyl-2,6-bis(2-methylpyrazol-2-ium-1-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 123422045 |
| Molecular Formula | C15H20N5+3 |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1,4-dimethyl-2,6-bis(2-methylpyrazol-2-ium-1-yl)pyridin-1-ium |
| SMILES | Cc1cc(-n2ccc[n+]2C)[n+](C)c(-n2ccc[n+]2C)c1 |
| InChI | InChI=1S/C15H20N5/c1-13-11-14(19-9-5-7-16(19)2)18(4)15(12-13)20-10-6-8-17(20)3/h5-12H,1-4H3/q+3 |
| InChIKey | IDNOGHXFLQUOKN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 21.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|