C28H31N2+ — CID 158426429
1-(2,8,11,11,12,12-hexamethylchrysen-3-yl)-2-methylpyrazol-2-ium (PubChem CID 158426429) has the molecular formula C28H31N2+ and a molecular weight of 395.57 g/mol. Its IUPAC name is 1-(2,8,11,11,12,12-hexamethylchrysen-3-yl)-2-methylpyrazol-2-ium.
| Compound Name | 1-(2,8,11,11,12,12-hexamethylchrysen-3-yl)-2-methylpyrazol-2-ium |
|---|---|
| PubChem CID | 158426429 |
| Molecular Formula | C28H31N2+ |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 1-(2,8,11,11,12,12-hexamethylchrysen-3-yl)-2-methylpyrazol-2-ium |
| SMILES | Cc1ccc2c3c(ccc2c1)-c1cc(-n2ccc[n+]2C)c(C)cc1C(C)(C)C3(C)C |
| InChI | InChI=1S/C28H31N2/c1-18-9-11-21-20(15-18)10-12-22-23-17-25(30-14-8-13-29(30)7)19(2)16-24(23)27(3,4)28(5,6)26(21)22/h8-17H,1-7H3/q+1 |
| InChIKey | NAWNOFPQUVTHSU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|