C11H15N3+2 — CID 170150348
1,2-dimethyl-6-(2-methylpyrazol-2-ium-1-yl)pyridin-1-ium (PubChem CID 170150348) has the molecular formula C11H15N3+2 and a molecular weight of 189.26 g/mol. Its IUPAC name is 1,2-dimethyl-6-(2-methylpyrazol-2-ium-1-yl)pyridin-1-ium.
| Compound Name | 1,2-dimethyl-6-(2-methylpyrazol-2-ium-1-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 170150348 |
| Molecular Formula | C11H15N3+2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1,2-dimethyl-6-(2-methylpyrazol-2-ium-1-yl)pyridin-1-ium |
| SMILES | Cc1cccc(-n2ccc[n+]2C)[n+]1C |
| InChI | InChI=1S/C11H15N3/c1-10-6-4-7-11(13(10)3)14-9-5-8-12(14)2/h4-9H,1-3H3/q+2 |
| InChIKey | ATLFDDAISYFXKD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 12.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|