C9H15N2+ — CID 23389059
N,N,1,6-tetramethylpyridin-1-ium-2-amine (PubChem CID 23389059) has the molecular formula C9H15N2+ and a molecular weight of 151.23 g/mol. Its IUPAC name is N,N,1,6-tetramethylpyridin-1-ium-2-amine.
| Compound Name | N,N,1,6-tetramethylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 23389059 |
| Molecular Formula | C9H15N2+ |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.12 |
| IUPAC Name | N,N,1,6-tetramethylpyridin-1-ium-2-amine |
| SMILES | Cc1cccc(N(C)C)[n+]1C |
| InChI | InChI=1S/C9H15N2/c1-8-6-5-7-9(10(2)3)11(8)4/h5-7H,1-4H3/q+1 |
| InChIKey | HRHZIJXMZCNVDU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|