C17H21BN2 — CID 166020451
2-(2,6-dimethylphenyl)-1,3,5-trimethyl-1,3,2-benzodiazaborole (PubChem CID 166020451) has the molecular formula C17H21BN2 and a molecular weight of 264.18 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-1,3,5-trimethyl-1,3,2-benzodiazaborole.
| Compound Name | 2-(2,6-dimethylphenyl)-1,3,5-trimethyl-1,3,2-benzodiazaborole |
|---|---|
| PubChem CID | 166020451 |
| Molecular Formula | C17H21BN2 |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-1,3,5-trimethyl-1,3,2-benzodiazaborole |
| SMILES | Cc1ccc2c(c1)N(C)B(c1c(C)cccc1C)N2C |
| InChI | InChI=1S/C17H21BN2/c1-12-9-10-15-16(11-12)20(5)18(19(15)4)17-13(2)7-6-8-14(17)3/h6-11H,1-5H3 |
| InChIKey | PGYKARHESJCDOY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|