C22H24B2N4 — CID 161478408
2-[4-(1,3-dimethyl-1,3,2-benzodiazaborol-2-yl)phenyl]-1,3-dimethyl-1,3,2-benzodiazaborole (PubChem CID 161478408) has the molecular formula C22H24B2N4 and a molecular weight of 366.09 g/mol. Its IUPAC name is 2-[4-(1,3-dimethyl-1,3,2-benzodiazaborol-2-yl)phenyl]-1,3-dimethyl-1,3,2-benzodiazaborole.
| Compound Name | 2-[4-(1,3-dimethyl-1,3,2-benzodiazaborol-2-yl)phenyl]-1,3-dimethyl-1,3,2-benzodiazaborole |
|---|---|
| PubChem CID | 161478408 |
| Molecular Formula | C22H24B2N4 |
| Molecular Weight | 366.09 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-[4-(1,3-dimethyl-1,3,2-benzodiazaborol-2-yl)phenyl]-1,3-dimethyl-1,3,2-benzodiazaborole |
| SMILES | CN1B(c2ccc(B3N(C)c4ccccc4N3C)cc2)N(C)c2ccccc21 |
| InChI | InChI=1S/C22H24B2N4/c1-25-19-9-5-6-10-20(19)26(2)23(25)17-13-15-18(16-14-17)24-27(3)21-11-7-8-12-22(21)28(24)4/h5-16H,1-4H3 |
| InChIKey | WEAHXIJKQKSQMI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.09 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|